CAS 50434-36-1
:(4-nitrophenyl)acetyl chloride
Description:
(4-Nitrophenyl)acetyl chloride, with the CAS number 50434-36-1, is an organic compound characterized by the presence of both an acetyl chloride functional group and a nitrophenyl moiety. It typically appears as a yellow to orange liquid, reflecting the influence of the nitro group on its color. This compound is known for its reactivity, particularly in acylation reactions, where it can introduce the acetyl group into various nucleophiles, including amines and alcohols. The presence of the electron-withdrawing nitro group enhances the electrophilicity of the carbonyl carbon, making it more susceptible to nucleophilic attack. (4-Nitrophenyl)acetyl chloride is also sensitive to moisture and should be handled under anhydrous conditions, as it can hydrolyze to form the corresponding acid. It is utilized in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals. Safety precautions are essential when working with this compound due to its corrosive nature and potential to cause irritation upon contact with skin or mucous membranes.
Formula:C8H6ClNO3
InChI:InChI=1/C8H6ClNO3/c9-8(11)5-6-1-3-7(4-2-6)10(12)13/h1-4H,5H2
SMILES:c1cc(ccc1CC(=O)Cl)N(=O)=O
Synonyms:- 4-Nitrobenzeneacetyl chloride
- Benzeneacetyl Chloride, 4-Nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(4-Nitrophenyl)acetyl chloride
CAS:(4-Nitrophenyl)acetyl chloridePurity:95%Molecular weight:199.59g/mol4-Nitro-benzeneacetyl chloride
CAS:4-Nitrobenzeneacetyl chloride is an amide with a heterocyclic amine group. It has been shown to have inhibitory activities against the growth of bacteria in acidic conditions, such as ph 3.5, and also inhibits the growth of bacteria in neutral conditions, such as ph 7.4. The functional groups on this compound are chlorides and phenyl groups. This compound does not have any halides or hydrochloric acid present in its structure. Nitrobenzeneacetyl chloride is unsymmetrical and has a benzene ring that is attached to an acetyl group.Formula:C8H6ClNO3Purity:Min. 95%Color and Shape:SolidMolecular weight:199.59 g/mol

