CAS 50438-75-0
:2-[4-(dimethylamino)phenyl]ethanol
Description:
2-[4-(Dimethylamino)phenyl]ethanol, also known by its CAS number 50438-75-0, is an organic compound characterized by its structure, which features a phenolic group substituted with a dimethylamino group and an ethanol moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxyl (-OH) group. The dimethylamino group contributes to its basicity and potential as a nucleophile in various chemical reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs or as a reagent in organic synthesis. Its properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other functional groups in a reaction mixture. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C10H15NO
InChI:InChI=1/C10H15NO/c1-11(2)10-5-3-9(4-6-10)7-8-12/h3-6,12H,7-8H2,1-2H3
SMILES:CN(C)c1ccc(cc1)CCO
Synonyms:- 4-(Dimethylamino)Phenethyl Alcohol
- 2-(4-Dimethylaminophenyl)-ethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(Dimethylamino)phenethyl alcohol
CAS:Formula:C10H15NOPurity:97%Color and Shape:SolidMolecular weight:165.23224-(Dimethylamino)phenethyl alcohol
CAS:4-(Dimethylamino)phenethyl alcoholPurity:99%Molecular weight:165.23g/mol2-(4-(Dimethylamino)phenyl)ethanol
CAS:Please enquire for more information about 2-(4-(Dimethylamino)phenyl)ethanol including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C10H15NOPurity:Min. 99.0 Area-%Molecular weight:165.23 g/mol2-[4-(Dimethylamino)phenyl]ethanol
CAS:Formula:C10H15NOPurity:97%Color and Shape:SolidMolecular weight:165.236



