CAS 50440-30-7
:4-[(6-nitroquinolin-4-yl)amino]-N-[4-(pyridin-4-ylamino)phenyl]benzamide
Description:
The chemical substance known as 4-[(6-nitroquinolin-4-yl)amino]-N-[4-(pyridin-4-ylamino)phenyl]benzamide, with the CAS number 50440-30-7, is a complex organic compound characterized by its multi-ring structure and the presence of various functional groups. It features a quinoline moiety, which is known for its aromatic properties and potential biological activity, particularly in medicinal chemistry. The nitro group attached to the quinoline enhances its reactivity and may influence its pharmacological profile. Additionally, the compound contains an amide linkage, which is significant for its stability and solubility in various solvents. The presence of pyridine and phenyl groups suggests potential interactions with biological targets, making it a candidate for research in drug development. Its structural complexity may contribute to unique properties, such as selective binding to specific receptors or enzymes. Overall, this compound exemplifies the intricate design often found in pharmaceutical chemistry, where modifications to the molecular structure can lead to varied biological activities.
Formula:C27H20N6O3
InChI:InChI=1/C27H20N6O3/c34-27(32-21-7-5-19(6-8-21)30-22-11-14-28-15-12-22)18-1-3-20(4-2-18)31-26-13-16-29-25-10-9-23(33(35)36)17-24(25)26/h1-17H,(H,28,30)(H,29,31)(H,32,34)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
T3Inh-1
CAS:T3Inh-1 is a potent and selective ppGalNAc-T3 inhibitor with IC50 of 7 µM.Cost-effective and quality-assured.
Formula:C27H20N6O3Purity:97.21%Color and Shape:SolidMolecular weight:476.494-[(6-Nitroquinolin-4-yl)amino]-N-[4-(pyridin-4-ylamino)phenyl]benzamide
CAS:4-[(6-Nitroquinolin-4-yl)amino]-N-[4-(pyridin-4-ylamino)phenyl]benzamide is a research tool used in pharmacology and cell biology. It is a potent inhibitor of voltage-gated potassium channels (Kv1.2 and Kv1.3). This compound binds to the extracellular domain of the potassium channel, blocking the ion channel pore and inhibiting ion flow through it. As a result, this inhibits neuronal firing, which can be useful for treating epilepsy. The high purity of this compound makes it an ideal candidate as a research tool in cell biology.
Formula:C27H20N6O3Purity:Min. 95%Molecular weight:476.5 g/molRef: 3D-ACA44030
Discontinued product


