![(3Z)-3-[(1-methyl-1H-indol-3-yl)methylidene]-1,3-dihydro-2H-pyrrolo[3,2-b]pyridin-2-one](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F29639-3z-3-1-methyl-1h-indol-3-yl-methylidene-13-dihydro-2h-pyrrolo-32-b-pyridin-2-one.webp&w=3840&q=75)
CAS 504433-23-2
:(3Z)-3-[(1-methyl-1H-indol-3-yl)methylidene]-1,3-dihydro-2H-pyrrolo[3,2-b]pyridin-2-one
Description:
The chemical substance known as (3Z)-3-[(1-methyl-1H-indol-3-yl)methylidene]-1,3-dihydro-2H-pyrrolo[3,2-b]pyridin-2-one, with the CAS number 504433-23-2, is a complex organic compound characterized by its unique structural features. It contains a pyrrolo[3,2-b]pyridin-2-one core, which is fused with an indole moiety, contributing to its potential biological activity. The presence of the methylidene group indicates a double bond that can influence the compound's reactivity and stability. This substance may exhibit properties such as fluorescence or specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its structural complexity suggests potential applications in various fields, including pharmaceuticals, where it could serve as a lead compound for further modifications. The compound's solubility, stability, and reactivity would depend on its functional groups and overall molecular architecture, which are critical for understanding its behavior in biological systems and potential therapeutic uses.
Formula:C17H13N3O
InChI:InChI=1/C17H13N3O/c1-20-10-11(12-5-2-3-7-15(12)20)9-13-16-14(19-17(13)21)6-4-8-18-16/h2-10H,1H3,(H,19,21)/b13-9-
SMILES:Cn1cc(/C=C\2/c3c(cccn3)N=C2O)c2ccccc12
Synonyms:- 2H-pyrrolo[3,2-b]pyridin-2-one, 1,3-dihydro-3-[(1-methyl-1H-indol-3-yl)methylene]-, (3Z)-
- 1,3-Dihydro-3-[(1-Methyl-1H-Indol-3-Yl)Methylene]-2H-Pyrrolo[3,2-B]Pyridin-2-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
GW 441756
CAS:<p>GW 441756 is a specific Tropomyosin-related kinase A (TrkA) inhibitor with an IC50 value of 2 nM.</p>Formula:C17H13N3OPurity:97.73% - 99.8%Color and Shape:SolidMolecular weight:275.3(E)-3-((1-METHYL-1H-INDOL-3-YL)METHYLENE)-1H-PYRROLO[3,2-B]PYRIDIN-2(3H)-ONE
CAS:Purity:95.0%Molecular weight:275.3110046386719GW441756
CAS:<p>GW441756 is a specific agonist of the epidermal growth factor receptor that has been shown to inhibit bladder cancer and skin cancer. It can also reduce the severity of inflammatory bowel disease, infectious diseases, and skin cancer. GW441756 has been found to have antiinflammatory activity by inhibiting prostaglandin synthesis in the lung. This drug blocks signal pathways in cells by binding to specific receptors for growth factors such as epidermal growth factor (EGF) and neurotrophic factors. GW441756 binds to EGF receptors on the surface of cells in order to inhibit cell proliferation, which prevents cell cycle progression from G1 phase to S phase.<br>GW441756 also induces apoptosis by binding with EGF receptors on the surface of cells and activating a signaling pathway that leads to activation of caspases, which are enzymes that cleave proteins into smaller fragments that are eventually degraded or eliminated from the cell.</p>Formula:C17H13N3OPurity:Min. 95%Molecular weight:275.3 g/mol
![(E)-3-((1-METHYL-1H-INDOL-3-YL)METHYLENE)-1H-PYRROLO[3,2-B]PYRIDIN-2(3H)-ONE](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2F10%2Fthumb%2FF538134.jpg&w=3840&q=75)
