CymitQuimica logo

CAS 504433-86-7

:

4-Fluoro-trans-beta-styrylboronic acid pinacol ester

Description:
4-Fluoro-trans-beta-styrylboronic acid pinacol ester is an organoboron compound characterized by the presence of a boronic acid functional group, which is typically used in organic synthesis, particularly in cross-coupling reactions such as Suzuki-Miyaura coupling. This compound features a fluoro-substituted styryl group, which can influence its reactivity and solubility. The pinacol ester moiety enhances the stability of the boronic acid, making it more suitable for various synthetic applications. Generally, boronic esters are known for their ability to form stable complexes with diols and can participate in diverse chemical transformations. The presence of the fluorine atom may impart unique electronic properties, potentially affecting the compound's reactivity and interaction with other molecules. Additionally, the compound's structure suggests it may exhibit specific physical properties such as solubility in organic solvents and potential applications in medicinal chemistry and materials science. Overall, 4-Fluoro-trans-beta-styrylboronic acid pinacol ester is a valuable intermediate in the synthesis of complex organic molecules.
Formula:C14H18BFO2
InChI:InChI=1S/C14H18BFO2/c1-13(2)14(3,4)18-15(17-13)10-9-11-5-7-12(16)8-6-11/h5-10H,1-4H3/b10-9+
InChI key:ZJRAXVMUDOVAOD-MDZDMXLPSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC=C(C=C2)F
Found 6 products.