CAS 50444-54-7
:Z-Ala-Ala-NH2
Description:
Z-Ala-Ala-NH2, also known as Z-Ala-Ala-amide, is a dipeptide derivative characterized by the presence of two alanine amino acids linked by a peptide bond, with a protective Z (benzyloxycarbonyl) group at the N-terminus and an amide group at the C-terminus. This compound is typically used in peptide synthesis and research due to its stability and ability to serve as a building block for more complex peptides. The Z group protects the amino group from unwanted reactions during synthesis, allowing for selective modifications. Z-Ala-Ala-NH2 is soluble in polar solvents, making it suitable for various biochemical applications. Its structure contributes to its properties, such as potential interactions in biological systems and its role in studies related to peptide behavior, enzyme activity, and drug design. As with many peptides, its biological activity can be influenced by the specific sequence and modifications, making it a valuable compound in the field of medicinal chemistry and biochemistry.
Formula:C14H19N3O4
InChI:InChI=1/C14H19N3O4/c1-9(12(15)18)16-13(19)10(2)17-14(20)21-8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H2,15,18)(H,16,19)(H,17,20)
SMILES:CC(C(=N)O)N=C(C(C)N=C(O)OCc1ccccc1)O
Synonyms:- N-[(benzyloxy)carbonyl]alanylalaninamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Z-Ala-Ala-NH2
CAS:Z-Ala-Ala-NH2 is a peptide that has been modified. Z-Ala-Ala-NH2 is a hydrolase and has the ability to hydrolyze peptides. It can be used in organic solvents as an unmodified hydrolase, or it can be modified with a nucleophile (such as an amine) to produce an active hydrolase. The unmodified form of Z-Ala-Ala-NH2 has been shown to have high yields and specificity for peptidyl substrates. This modification is also useful for the synthesis of amide bonds in peptides, which are more stable than ester bonds.Formula:C14H19N3O4Purity:Min. 95%Molecular weight:293.32 g/mol
