CAS 50446-44-1
:4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid
Description:
4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid, also known by its CAS number 50446-44-1, is an organic compound characterized by its complex aromatic structure. This substance features multiple carboxylic acid functional groups, which contribute to its acidic properties and potential for forming hydrogen bonds. The presence of phenyl rings enhances its stability and contributes to its potential applications in materials science, particularly in the development of polymers and liquid crystals. The compound's solubility can vary depending on the solvent, influenced by the carboxylic acid groups that can engage in ionic interactions. Additionally, its structural features may impart interesting optical properties, making it a candidate for use in photonic applications. The compound's synthesis typically involves multi-step organic reactions, and its characterization can be performed using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Overall, this compound is of interest in both academic research and industrial applications due to its unique chemical properties.
Formula:C27H18O6
InChI:InChI=1/C27H18O6/c28-25(29)19-7-1-16(2-8-19)22-13-23(17-3-9-20(10-4-17)26(30)31)15-24(14-22)18-5-11-21(12-6-18)27(32)33/h1-15H,(H,28,29)(H,30,31)(H,32,33)
SMILES:c1cc(ccc1c1cc(cc(c1)c1ccc(cc1)C(=O)O)c1ccc(cc1)C(=O)O)C(=O)O
Synonyms:- 1,3,5-Tri(4-carboxyphenyl)benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,3,5-Tris(4-carboxyphenyl)benzene
CAS:Formula:C27H18O6Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:438.441,3,5-Tri(4-carboxyphenyl)benzene, 97%
CAS:1,3,5-Tri(4-carboxyphenyl)benzene is used as a building block for metal organic frameworks, which is a 3D-microporous material and finds applications in gas adsorption and separation technologies. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfoli
Formula:C27H18O6Purity:97%Color and Shape:Powder, White to pale creamMolecular weight:438.431,3,5-Tris(4-carboxyphenyl)benzene, min. 98% BTB
CAS:1,3,5-Tris(4-carboxyphenyl)benzene, min. 98% BTB
Formula:C27H18O6Purity:min. 98%Color and Shape:white to yellow solidMolecular weight:438.435'-(4-Carboxyphenyl)-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid
CAS:Formula:C27H18O6Purity:97%Color and Shape:SolidMolecular weight:438.42821,3,5-Tri(4-carboxyphenyl)benzene
CAS:1,3,5-Tri(4-carboxyphenyl)benzenePurity:98%Molecular weight:438.43g/mol1,3,5-Tri(4-carboxyphenyl)benzene
CAS:Purity:98%Color and Shape:SolidMolecular weight:438.43499755859375





