CAS 50461-86-4

5,7-dihydroxy-3,6,8-trimethoxy-2-(4-methoxyphenyl)-4H-chromen-4-one

Description:

5,7-Dihydroxy-3,6,8-trimethoxy-2-(4-methoxyphenyl)-4H-chromen-4-one, with the CAS number 50461-86-4, is a flavonoid compound characterized by its complex polyphenolic structure. This compound features multiple methoxy groups and hydroxyl substituents, which contribute to its potential antioxidant properties. The presence of the chromone backbone is indicative of its classification within the flavonoid family, which is known for various biological activities, including anti-inflammatory, antimicrobial, and anticancer effects. The methoxy and hydroxyl groups enhance its solubility and reactivity, making it a subject of interest in pharmacological studies. Additionally, the compound's structural features suggest it may interact with various biological targets, potentially influencing cellular signaling pathways. Its unique arrangement of functional groups may also contribute to its stability and bioavailability, making it a candidate for further research in medicinal chemistry and natural product synthesis. Overall, this compound exemplifies the diverse chemistry of flavonoids and their relevance in health and disease.

Formula: C₁₉H₁₈O₈

InChI: InChI=1/C19H18O8/c1-23-10-7-5-9(6-8-10)15-18(25-3)13(21)11-12(20)17(24-2)14(22)19(26-4)16(11)27-15/h5-8,20,22H,1-4H3

SMILES: COc1ccc(cc1)c1c(c(=O)c2c(c(c(c(c2o1)OC)O)OC)O)OC

Araneosol

CAS: 50461-86-4

Araneosol is a natural product of Ehretia, Boraginaceae.

Formula: C₁₉H₁₈O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 374.34

Ref: TM-TN3437

Araneosol

CAS: 50461-86-4

Formula: C₁₉H₁₈O₈

Purity: 95%~99%

Color and Shape: Yellow powder

Molecular weight: 374.345

Ref: BP-SBP00234

Araneosol

CAS: 50461-86-4

Araneosol is an innovative biotechnological product, which is derived from naturally occurring compounds found in spider venom. Its mode of action involves targeting the neuromuscular systems of specific pest organisms, leading to a precise and efficient incapacitation without wide-reaching ecological impacts. Araneosol is meticulously engineered to exploit peptide and protein components that are highly selective for pest-specific ion channels.

Formula: C₁₉H₁₈O₈

Purity: Min. 95%

Molecular weight: 374.3 g/mol

Ref: 3D-ACA46186