CAS 50463-48-4
:3-[4-(benzyloxy)phenyl]propanoic acid
Description:
3-[4-(Benzyloxy)phenyl]propanoic acid, with the CAS number 50463-48-4, is an organic compound characterized by its structure, which includes a propanoic acid moiety attached to a phenyl group that is further substituted with a benzyloxy group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions due to the presence of functional groups. The benzyloxy group enhances its lipophilicity, which may influence its solubility in organic solvents compared to water. The presence of the carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular interactions can be influenced by the steric and electronic effects of the substituents, which may affect its reactivity and interactions with biological targets. Overall, 3-[4-(benzyloxy)phenyl]propanoic acid is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C16H16O3
InChI:InChI=1/C16H16O3/c17-16(18)11-8-13-6-9-15(10-7-13)19-12-14-4-2-1-3-5-14/h1-7,9-10H,8,11-12H2,(H,17,18)
SMILES:c1ccc(cc1)COc1ccc(cc1)CCC(=O)O
Synonyms:- 3-(4-Benzyloxyphenyl)propionic acid
- 50463-48-4
- Qv2R Do1R
- 3-[4-(Benzyloxy)phenyl]propanoic acid
- Benzenepropanoic acid, 4-(phenylmethoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-[4-(Benzyloxy)phenyl]propionic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C16H16O3Purity:96%Color and Shape:White to pale cream, PowderMolecular weight:256.303-[4-(BENZYLOXY)PHENYL]PROPIONIC ACID
CAS:Formula:C16H16O3Purity:98%Color and Shape:SolidMolecular weight:256.29643-(4-(Benzyloxy)phenyl)propanoic acid
CAS:3-(4-(Benzyloxy)phenyl)propanoic acidPurity:99%Molecular weight:256.30g/mol3-(4-Benzyloxyphenyl)propionic acid
CAS:Formula:C16H16O3Purity:95%Color and Shape:SolidMolecular weight:256.301



