CAS 50487-72-4

4-methyl-N,N-di(prop-2-en-1-yl)benzenesulfonamide

Description:

4-Methyl-N,N-di(prop-2-en-1-yl)benzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its applications in pharmaceuticals and agrochemicals. The compound features a benzene ring substituted with a methyl group and two prop-2-en-1-yl groups, contributing to its unique reactivity and potential applications in organic synthesis. The presence of the sulfonamide group imparts properties such as solubility in polar solvents and the ability to form hydrogen bonds, which can enhance its biological activity. Additionally, the alkenyl substituents may allow for further chemical modifications through reactions such as polymerization or cross-coupling. The compound's molecular structure suggests it may exhibit interesting physical properties, including melting and boiling points influenced by the steric effects of the substituents. Overall, 4-methyl-N,N-di(prop-2-en-1-yl)benzenesulfonamide represents a versatile building block in synthetic chemistry, with potential implications in medicinal chemistry and material science.

Formula: C₁₃H₁₇NO₂S

InChI: InChI=1/C13H17NO2S/c1-4-10-14(11-5-2)17(15,16)13-8-6-12(3)7-9-13/h4-9H,1-2,10-11H2,3H3

SMILES: C=CCN(CC=C)S(=O)(=O)c1ccc(C)cc1

Synonyms:

• benzenesulfonamide, 4-methyl-N,N-di-2-propen-1-yl-
• N,N-Diallyl-4-methyl-benzenesulfonamide

N,N-Diallyl-4-methylbenzenesulfonamide

CAS: 50487-72-4

Formula: C₁₃H₁₇NO₂S

Purity: 95%

Color and Shape: Liquid

Molecular weight: 251.3446

Ref: IN-DA00DG1H

N,N-Diallyl-4-methylbenzenesulfonamide

CAS: 50487-72-4

N,N-Diallyl-4-methylbenzenesulfonamide

Formula: C₁₃H₁₇NO₂S

Purity: 98%

Color and Shape: yellow liquid

Molecular weight: 251.34458g/mol

Ref: 54-OR302738

N,N-Diallyl-4-methylbenzenesulfonamide

CAS: 50487-72-4

Formula: C₁₃H₁₇NO₂S

Purity: 98%

Color and Shape: Liquid

Molecular weight: 251.34

Ref: 10-F462448