CAS 50488-42-1
:2-Bromo-5-(trifluoromethyl)pyridine
Description:
2-Bromo-5-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a bromine atom and a trifluoromethyl group. The bromine atom is located at the second position, while the trifluoromethyl group is positioned at the fifth carbon of the pyridine ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It exhibits notable chemical reactivity due to the presence of both the bromine and trifluoromethyl groups, making it useful in various synthetic applications, particularly in the pharmaceutical and agrochemical industries. The trifluoromethyl group imparts unique electronic properties, enhancing the compound's lipophilicity and biological activity. Additionally, 2-Bromo-5-(trifluoromethyl)pyridine can participate in nucleophilic substitution reactions and is often employed as an intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C13H8F2O2
InChI:InChI=1/C13H8F2O2/c14-11-6-5-10(7-12(11)15)8-1-3-9(4-2-8)13(16)17/h1-7H,(H,16,17)
SMILES:c1cc(ccc1c1ccc(c(c1)F)F)C(=O)O
Synonyms:- 2-Brom-5-(trifluormethyl)pyridin
- Pyridine, 2-bromo-5-(trifluoromethyl)-
- 4-(3,4-Difluorophenyl)Benzoic Acid
- 2-Bromo-5-(trifluorométhyl)pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Bromo-5-trifluoromethylpyridine
CAS:Formula:C6H3BrF3NPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:226.002-Bromo-5-(trifluoromethyl)pyridine, 96%
CAS:2-Bromo-5-(trifluoromethyl)pyridine is a substrate used in a palladium-catalyzed -arylation of a Refomatsky reagent. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The oriFormula:C6H3BrF3NPurity:96%Color and Shape:White to pale cream, Crystalline powderMolecular weight:226.002-Bromo-5-(trifluoromethyl)pyridine
CAS:Formula:C6H3BrF3NPurity:98%Color and Shape:SolidMolecular weight:225.99392-Bromo-5-(trifluoromethyl)pyridine
CAS:2-Bromo-5-(trifluoromethyl)pyridineFormula:C6H3BrF3NPurity:97%Color and Shape: white solidMolecular weight:225.99g/mol2-Bromo-5-(trifluoromethyl)pyridine
CAS:Formula:C6H3BrF3NPurity:98%Color and Shape:Solid, Crystalline Powder or Needles or PowderMolecular weight:225.9962-Bromo-5-(trifluoromethyl)pyridine
CAS:Controlled ProductFormula:C6H3BrF3NColor and Shape:NeatMolecular weight:225.99






