CAS 50488-89-6

3-[(β-D-Glucopyranosyloxy)methyl]-1,8-dihydroxy-9,10-anthracenedione

Description:

3-[(β-D-Glucopyranosyloxy)methyl]-1,8-dihydroxy-9,10-anthracenedione, with CAS number 50488-89-6, is a chemical compound that belongs to the class of anthraquinones, which are known for their vibrant colors and biological activities. This compound features a glucopyranosyl moiety, indicating that it has a sugar component that can enhance its solubility and biological interactions. The presence of hydroxyl groups contributes to its potential reactivity and ability to form hydrogen bonds, which may influence its solubility in various solvents. The anthraquinone structure is often associated with various pharmacological properties, including antimicrobial and anticancer activities. Additionally, the glycosylation of the compound may affect its bioavailability and metabolic stability. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, showcasing how modifications to a core structure can lead to diverse functional properties.

Formula: C₂₁H₂₀O₁₀

InChI: InChI=1S/C21H20O10/c22-6-13-17(26)19(28)20(29)21(31-13)30-7-8-4-10-15(12(24)5-8)18(27)14-9(16(10)25)2-1-3-11(14)23/h1-5,13,17,19-24,26,28-29H,6-7H2/t13-,17-,19+,20-,21-/m1/s1

InChI key: InChIKey=ASQHVCDULHERIH-JNHRPPPUSA-N

SMILES: O=C1C=2C(C(=O)C=3C1=CC=CC3O)=C(O)C=C(CO[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C2

Synonyms:

• 9,10-Anthracenedione, 3-[(β-D-glucopyranosyloxy)methyl]-1,8-dihydroxy-
• 3-[(β-D-Glucopyranosyloxy)methyl]-1,8-dihydroxy-9,10-anthracenedione

Aloe-emodin-3-(hydroxymethyl)-O-β-D-glucopyranoside

CAS: 50488-89-6

Aloe-emodin-3-(hydroxymethyl)-O-beta-D-glucopyranoside is a natural product

Formula: C₂₁H₂₀O₁₀

Purity: 98%

Color and Shape: Solid

Molecular weight: 432.38

Ref: TM-TN1371

Aloe-emodin-3-(hydroxymethyl)-O-²-D-glucopyranoside

CAS: 50488-89-6

Aloe-emodin-3-(hydroxymethyl)-O-β-D-glucopyranoside is an anthraquinone glycoside, which is derived from natural plant sources, primarily from species within the Aloe genus. This compound represents a specialized metabolite that is typically found in aloe vera and other related plants. Its mode of action involves modulation of various cellular pathways, notably impacting cell proliferation and apoptosis, which makes it a subject of interest in cancer research and other therapeutic domains.

Formula: C₂₁H₂₀O₁₀

Purity: Min. 95%

Molecular weight: 432.38 g/mol

Ref: 3D-ACA48889