CAS 505-34-0
:Cheirolin
Description:
Cheirolin, with the CAS number 505-34-0, is a chemical compound that belongs to the class of organic compounds known as alkaloids. It is primarily derived from natural sources, particularly certain plant species. Cheirolin is characterized by its complex molecular structure, which typically includes multiple functional groups that contribute to its biological activity. This compound has been studied for its potential pharmacological properties, including its effects on the central nervous system and its possible applications in medicinal chemistry. Cheirolin may exhibit various biological activities, such as antimicrobial or anti-inflammatory effects, although specific mechanisms of action can vary. Its solubility, stability, and reactivity are influenced by environmental factors and the presence of other chemical species. As with many alkaloids, safety and toxicity profiles are important considerations in its use, necessitating careful handling and thorough research to understand its effects in biological systems. Overall, Cheirolin represents a fascinating area of study within the field of natural products and medicinal chemistry.
Formula:C5H9NO2S2
InChI:InChI=1S/C5H9NO2S2/c1-10(7,8)4-2-3-6-5-9/h2-4H2,1H3
InChI key:InChIKey=ZSJGCHNCYSHQEU-UHFFFAOYSA-N
SMILES:C(CS(C)(=O)=O)CN=C=S
Synonyms:- 1-Isothiocyanato-3-(methylsulfonyl)propane
- Cheirolin
- Isothiocyanic acid, 3-(methylsulfonyl)propyl ester
- Methylpropylsulfone mustard oil
- Propane, 1-isothiocyanato-3-(methylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
