
CAS 505-56-6
:Docosanedioic acid
Description:
Docosanedioic acid, also known as behenic acid, is a long-chain dicarboxylic acid characterized by its two carboxyl functional groups (-COOH) at each end of a 22-carbon linear alkane chain. It is a white, waxy solid at room temperature and is insoluble in water but soluble in organic solvents such as ethanol and ether. This compound has a melting point that typically falls within the range of high melting point fatty acids, making it useful in various applications. Docosanedioic acid is primarily derived from natural sources, including certain plant oils and animal fats, and is often utilized in the production of surfactants, lubricants, and as an emulsifying agent in cosmetics and personal care products. Its long carbon chain contributes to its hydrophobic properties, while the dicarboxylic nature allows for potential reactivity in chemical synthesis. Additionally, it has been studied for its potential health benefits and applications in biochemistry and materials science.
Formula:C22H42O4
InChI:InChI=1S/C22H42O4/c23-21(24)19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22(25)26/h1-20H2,(H,23,24)(H,25,26)
InChI key:InChIKey=DGXRZJSPDXZJFG-UHFFFAOYSA-N
SMILES:C(CC(O)=O)CCCCCCCCCCCCCCCCCCC(O)=O
Synonyms:- Docosanedioic acid
- Felogenic acid
- 1,20-Eicosanedicarboxylic acid
- 1,22-Docosanedioic acid
- Phellogenic acid
Sort by
Found 7 products.
Ref: 54-BUP17995
200mg53.00€Docosanedioic Acid
CAS:Controlled ProductApplications Docosanedioic Acid is a Suberin fatty acid. References Heinamaki, Jyrki, et al.: J. of Nat. Prod., 80(4), 916-924 (2017)Formula:C22H42O4Color and Shape:NeatMolecular weight:370.567Ref: TR-D678845
1g106.00€5g343.00€500mg91.00€Docosanedioic Acid
CAS:Formula:C22H42O4Purity:>95.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:370.57Ref: 3B-D3137
1g199.00€Docosanedioic acid
CAS:Docosanedioic acidFormula:C22H42O4Purity:99%Color and Shape: white solidMolecular weight:370.57g/molRef: 54-OR55199
1g36.00€5g95.00€25g393.00€100g1,206.00€250mg32.00€Ref: 10-F541418
1g46.00€5g117.00€25gTo inquire100g1,539.00€100mgTo inquire250mgTo inquireDocosanedioic acid
CAS:BEHENIC ACID is a alkyl-chain-based PROTAC linker. BEHENIC ACID is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs).Formula:C22H42O4Purity:≥98%Color and Shape:White SolidMolecular weight:370.57Ref: TM-T9784
200mg34.00€Ref: IN-DA00DEE8
1g40.00€5g79.00€10g126.00€25g196.00€100g521.00€100mg30.00€250mg30.00€