CAS 505071-98-7

3-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)-4-methylbenzoic acid

Description:

3-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)-4-methylbenzoic acid, with the CAS number 505071-98-7, is an organic compound characterized by its complex structure, which includes a pyrrole ring and a benzoic acid moiety. This compound features a formyl group and two methyl substituents on the pyrrole ring, contributing to its unique chemical properties. The presence of the carboxylic acid functional group in the benzoic acid part indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. Additionally, the compound's structure suggests potential applications in organic synthesis, pharmaceuticals, or as a building block in materials science due to its ability to form hydrogen bonds and engage in π-π stacking interactions. Its specific reactivity and stability would depend on the surrounding conditions, such as pH and temperature. Overall, this compound exemplifies the diversity of organic chemistry and the potential for functionalization in various chemical applications.

Formula: C₁₅H₁₅NO₃

InChI: InChI=1/C15H15NO3/c1-9-4-5-12(15(18)19)7-14(9)16-10(2)6-13(8-17)11(16)3/h4-8H,1-3H3,(H,18,19)

SMILES: Cc1ccc(cc1n1c(C)cc(C=O)c1C)C(=O)O

3-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)-4-methylbenzoic acid

CAS: 505071-98-7

Versatile small molecule scaffold

Formula: C₁₅H₁₅NO₃

Purity: Min. 95%

Molecular weight: 257.28 g/mol

Ref: 3D-FVA07198