CAS 505082-90-6

2-Fluoro-4-(2-thienyl)benzoic acid

Description:

2-Fluoro-4-(2-thienyl)benzoic acid is an organic compound characterized by its unique structure, which includes a benzoic acid moiety substituted with a fluorine atom and a thienyl group. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The thienyl group, derived from thiophene, introduces heteroatoms into the structure, which can affect the compound's electronic properties and interactions with biological targets. This compound is likely to exhibit acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, its structural features may confer specific pharmacological activities, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 2-Fluoro-4-(2-thienyl)benzoic acid represents a versatile building block in organic synthesis and may have potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₁H₇FO₂S

InChI: InChI=1S/C11H7FO2S/c12-9-6-7(10-2-1-5-15-10)3-4-8(9)11(13)14/h1-6H,(H,13,14)

InChI key: InChIKey=OCVGEXOQIJBJIP-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1C(O)=O)C2=CC=CS2

Synonyms:

• Benzoic acid, 2-fluoro-4-(2-thienyl)-
• 2-Fluoro-4-(thien-2-yl)benzoic acid
• 2-Fluoro-4-(thiophen-2-yl)benzoic acid
• 2-Fluoro-4-(2-thienyl)benzoic acid

2-Fluoro-4-(thiophen-2-yl)benzoic acid

CAS: 505082-90-6

Versatile small molecule scaffold

Formula: C₁₁H₇FO₂S

Purity: Min. 95%

Molecular weight: 222.24 g/mol

Ref: 3D-FVA08290