CAS 50517-10-7

N-Acetyl-6-chlorotryptophan

Description:

N-Acetyl-6-chlorotryptophan is an amino acid derivative characterized by the presence of an acetyl group and a chlorine atom at the 6-position of the tryptophan structure. This compound is a modified form of tryptophan, which is an essential amino acid known for its role in protein synthesis and as a precursor to neurotransmitters such as serotonin. The acetylation at the nitrogen atom enhances its solubility and may influence its biological activity. The chlorine substitution can affect the compound's reactivity and interaction with biological systems. N-Acetyl-6-chlorotryptophan is typically used in biochemical research and may have applications in drug development or as a biochemical probe due to its structural modifications. Its properties include being a solid at room temperature, with potential polar characteristics due to the acetyl group, and it may exhibit unique spectroscopic features that can be analyzed using techniques such as NMR or mass spectrometry. Overall, this compound represents an interesting variant of tryptophan with potential implications in various scientific fields.

Formula: C₁₃H₁₃ClN₂O₃

InChI: InChI=1S/C13H13ClN2O3/c1-7(17)16-12(13(18)19)4-8-6-15-11-5-9(14)2-3-10(8)11/h2-3,5-6,12,15H,4H2,1H3,(H,16,17)(H,18,19)

InChI key: InChIKey=LCLMWFCLWYOLIO-UHFFFAOYSA-N

SMILES: C(C(NC(C)=O)C(O)=O)C=1C=2C(NC1)=CC(Cl)=CC2

Synonyms:

• Tryptophan, N-acetyl-6-chloro-
• DL-Tryptophan, N-acetyl-6-chloro-
• 2-Acetamido-3-(6-chloro-1H-indol-3-yl)propanoic acid
• N-Acetyl-6-chloro-DL-tryptophan
• N-Acetyl-6-chlorotryptophan

N-Acetyl 6-Chlorotryptophan

Controlled Product

CAS: 50517-10-7

Applications A derivative of 6-Chlorotryptophan.

Formula: C₁₃H₁₃ClN₂O₃

Color and Shape: Neat

Molecular weight: 280.71

Ref: TR-A168430