CAS 50551-58-1
:Ethyl 7-methoxybenzofuran-2-carboxylate
Description:
Ethyl 7-methoxybenzofuran-2-carboxylate is an organic compound characterized by its benzofuran structure, which includes a methoxy group and an ethyl ester functional group. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating elements such as carbon, hydrogen, and oxygen. Ethyl 7-methoxybenzofuran-2-carboxylate is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique structural features that may influence biological activity. The presence of the methoxy group can enhance lipophilicity, potentially affecting the compound's solubility and permeability in biological systems. Additionally, the benzofuran moiety is often associated with various biological activities, including anti-inflammatory and antioxidant properties. The compound's synthesis usually involves multi-step organic reactions, and its characterization can be achieved through techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C12H12O4
InChI:InChI=1/C12H12O4/c1-3-15-12(13)10-7-8-5-4-6-9(14-2)11(8)16-10/h4-7H,3H2,1-2H3
SMILES:CCOC(=O)c1cc2cccc(c2o1)OC
Synonyms:- 7-Methoxy-2-benzofurancarboxylic acid ethyl ester
- Ethyl 7-Methoxy-1-Benzofuran-2-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 7-methoxybenzo[b]furan-2-carboxylate, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C12H12O4Purity:97%Color and Shape:White to cream to pale yellow, Crystals or powder or crystalline powderMolecular weight:220.22Ethyl 7-methoxybenzofuran-2-carboxylate
CAS:Formula:C12H12O4Purity:98%Color and Shape:SolidMolecular weight:220.2213Ethyl 7-methoxybenzofuran-2-carboxylate
CAS:Ethyl 7-methoxybenzofuran-2-carboxylatePurity:98%Molecular weight:220.224g/mol7-Methoxybenzofuran-2-carboxylic acid, ethyl ester
CAS:Formula:C12H12O4Purity:98%Color and Shape:SolidMolecular weight:220.224Ethyl 7-methoxy-1-benzofuran-2-carboxylate
CAS:<p>Versatile small molecule scaffold</p>Formula:C12H12O4Purity:Min. 95%Molecular weight:220.22 g/mol




