CymitQuimica logo

CAS 50562-19-1

:

Benzenemethanol, 4-fluoro-a-(trifluoromethyl)-

Description:
Benzenemethanol, 4-fluoro-α-(trifluoromethyl)-, also known by its CAS number 50562-19-1, is an organic compound characterized by the presence of a benzene ring substituted with a fluorine atom and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including a relatively high boiling point due to the influence of the trifluoromethyl group, which enhances its polarity. The presence of the fluorine atoms contributes to its chemical stability and can affect its reactivity, making it useful in various chemical syntheses and applications. Additionally, the compound may exhibit unique solubility characteristics, often being more soluble in polar solvents. Its structure suggests potential applications in pharmaceuticals, agrochemicals, and materials science, where fluorinated compounds are valued for their unique properties. Safety data should be consulted for handling and storage, as fluorinated compounds can pose specific health and environmental risks.
Formula:C8H6F4O
InChI:InChI=1S/C8H6F4O/c9-6-3-1-5(2-4-6)7(13)8(10,11)12/h1-4,7,13H
InChI key:BDQHSIMDNYIOMB-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C(C(F)(F)F)O)F
Found 4 products.