CAS 5057-96-5
:D-Dimethyl tartrate
Description:
D-Dimethyl tartrate, with the CAS number 5057-96-5, is an organic compound that belongs to the class of tartaric acid derivatives. It is a colorless to pale yellow liquid that is typically odorless or has a mild odor. This compound is characterized by its two ester functional groups, which contribute to its reactivity and solubility properties. D-Dimethyl tartrate is soluble in water and organic solvents, making it versatile for various applications. It is commonly used as a chiral building block in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, it serves as a chiral auxiliary in asymmetric synthesis, facilitating the formation of enantiomerically enriched compounds. The compound is stable under normal conditions but should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, D-Dimethyl tartrate is valued for its utility in synthetic chemistry and its role in producing chiral molecules.
Formula:C6H10O6
InChI:InChI=1/C6H10O6/c1-11-5(9)3(7)4(8)6(10)12-2/h3-4,7-8H,1-2H3/t3-,4+
Synonyms:- Dimethyl D-Tartrate
- Meso-tartaric acid, dimethyl ester
- Butanedioic acid, 2,3-dihydroxy-, dimethyl ester, (R*,S*)-
- Dimethyl D-Tartrate 99% (99+% Ee/Glc)
- Dimethyl (2S,3S)-2,3-Dihydroxybutanedioate
- D-(-)-Tartaric acid dimethyl ester
- dimethyl (2R,3R)-2,3-dihydroxybutanedioate
- Dimethyl 2,3-Dihydroxybutanedioate
- dimethyl (2R,3S)-2,3-dihydroxybutanedioate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2R,3S)-Dimethyl 2,3-dihydroxysuccinate
CAS:Formula:C6H10O6Purity:98%Color and Shape:SolidMolecular weight:178.1400(2R,3S)-Dimethyl 2,3-dihydroxysuccinate
CAS:(2R,3S)-Dimethyl 2,3-dihydroxysuccinatePurity:≥95%Molecular weight:178.139g/mol



