CAS 50573-74-5
:2-Amino-6-nitrobenzoic acid
Description:
2-Amino-6-nitrobenzoic acid, with the CAS number 50573-74-5, is an organic compound characterized by the presence of both amino and nitro functional groups attached to a benzoic acid structure. This compound typically appears as a yellow crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid and amino groups. The nitro group introduces significant electron-withdrawing properties, which can influence the compound's reactivity and acidity. 2-Amino-6-nitrobenzoic acid is often utilized in organic synthesis, particularly in the preparation of dyes, pharmaceuticals, and other chemical intermediates. Its unique functional groups allow for various chemical transformations, making it a valuable compound in research and industrial applications. Additionally, the compound's properties can be affected by pH and temperature, which may influence its solubility and stability. Overall, 2-Amino-6-nitrobenzoic acid serves as an important building block in the synthesis of more complex organic molecules.
Formula:C7H6N2O4
InChI:InChI=1S/C7H6N2O4/c8-4-2-1-3-5(9(12)13)6(4)7(10)11/h1-3H,8H2,(H,10,11)
InChI key:InChIKey=GGKYLHNARFFORH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N(=O)=O)C=CC=C1N
Synonyms:- 6-Nitro-2-aminobenzoic acid
- 6-Nitroanthranilic acid
- Anthranilic acid, 6-nitro-
- Benzoic acid, 2-amino-6-nitro-
- Nsc 36953
- 2-Amino-6-nitrobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Amino-6-nitrobenzoic Acid
CAS:Formula:C7H6N2O4Purity:>97.0%(T)(HPLC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:182.142-Amino-6-nitrobenzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H6N2O4Purity:97%Molecular weight:182.142-Amino-6-nitrobenzoic acid
CAS:Formula:C7H6N2O4Purity:99%Color and Shape:SolidMolecular weight:182.13352-Amino-6-nitrobenzoic acid
CAS:2-Amino-6-nitrobenzoic acidFormula:C7H6N2O4Purity:≥95%Color and Shape: yellow to dark yellow powderMolecular weight:182.13g/mol2-Amino-6-nitrobenzoic acid
CAS:Formula:C7H6N2O4Purity:98%Color and Shape:Solid, Pale yellow to yellow red powderMolecular weight:182.135






