CymitQuimica logo

CAS 5058-01-5

:

3-hydroxytetrahydro-2H-pyran-2-one

Description:
3-Hydroxytetrahydro-2H-pyran-2-one, also known by its CAS number 5058-01-5, is a cyclic compound characterized by a six-membered ring containing both oxygen and carbon atoms. This compound features a hydroxyl group (-OH) and a carbonyl group (C=O) within its structure, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the hydroxyl group makes it a potential candidate for hydrogen bonding, influencing its solubility in polar solvents such as water and alcohols. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmaceuticals. Its stability and reactivity can vary based on environmental conditions, such as temperature and pH. Overall, 3-hydroxytetrahydro-2H-pyran-2-one is a versatile compound with potential applications in various fields, including organic synthesis and drug development.
Formula:C5H8O3
InChI:InChI=1/C5H8O3/c6-4-2-1-3-8-5(4)7/h4,6H,1-3H2
InChI key:FHSAZOGISLHXPK-UHFFFAOYSA-N
SMILES:C1CC(C(=O)OC1)O
Found 2 products.