CAS 50590-07-3

4-iodo-3-nitrophenol

Description:

4-Iodo-3-nitrophenol is an organic compound characterized by the presence of both an iodine and a nitro group attached to a phenolic ring. Its molecular structure features a hydroxyl group (-OH) that contributes to its acidic properties, making it a weak acid. The iodine atom, being a halogen, introduces significant electronegativity, which influences the compound's reactivity and stability. The nitro group (-NO2) is a strong electron-withdrawing group, enhancing the compound's electrophilic character and making it useful in various chemical reactions, including nucleophilic substitutions. This compound is typically a solid at room temperature and may exhibit yellow to brown coloration, depending on its purity and form. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic aromatic structure. 4-Iodo-3-nitrophenol is often utilized in research and industrial applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. Proper handling and safety measures are essential, as it may pose health risks upon exposure.

Formula: C₆H₄INO₃

InChI: InChI=1/C6H4INO3/c7-5-2-1-4(9)3-6(5)8(10)11/h1-3,9H

SMILES: c1cc(c(cc1O)N(=O)=O)I

Synonyms:

• Phenol, 4-Iodo-3-Nitro-

3-Iodo-4-nitrophenol

CAS: 50590-07-3

3-Iodo-4-nitrophenol

Purity: 97%

Molecular weight: 265.01g/mol

Ref: 54-OR400409

3-Iodo-4-nitrophenol

CAS: 50590-07-3

Formula: C₆H₄INO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 265.006

Ref: 10-F092857

3-Iodo-4-nitrophenol

CAS: 50590-07-3

Formula: C₆H₄INO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 265.0053

Ref: IN-DA0037SN