CAS 50593-92-5

5-Bromo-2-(methylthio)pyrimidine-4-carboxylic acid

Description:

5-Bromo-2-(methylthio)pyrimidine-4-carboxylic acid is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains both bromine and a methylthio group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and potential applications in synthesis and medicinal chemistry. The methylthio group contributes to the compound's overall polarity and can affect its solubility in various solvents. The carboxylic acid functional group is significant for its acidity and ability to participate in various chemical reactions, such as esterification or amidation. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, reactivity, and solubility characteristics are essential for its use in laboratory settings and industrial applications. Overall, 5-Bromo-2-(methylthio)pyrimidine-4-carboxylic acid is a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₆H₅BrN₂O₂S

InChI: InChI=1/C6H5BrN2O2S/c1-12-6-8-2-3(7)4(9-6)5(10)11/h2H,1H3,(H,10,11)

SMILES: CSc1ncc(c(C(=O)O)n1)Br

Synonyms:

• 4-Pyrimidinecarboxylic acid, 5-bromo-2-(methylthio)-
• 5-Bromo-2-(methylsulfanyl)pyrimidine-4-carboxylic acid

5-Bromo-2-(Methylthio)Pyrimidine-4-Carboxylic Acid

CAS: 50593-92-5

Formula: C₆H₅BrN₂O₂S

Purity: 96%

Color and Shape: Solid

Molecular weight: 249.0851

Ref: IN-DA003479

5-Bromo-2-(methylsulphanyl)pyrimidine-4-carboxylic acid

CAS: 50593-92-5

5-Bromo-2-(methylsulphanyl)pyrimidine-4-carboxylic acid

Formula: C₆H₅BrN₂O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 249.09g/mol

Ref: 54-OR6988

5-Bromo-2-(methylthio)pyrimidine-4-carboxylic Acid

CAS: 50593-92-5

Formula: C₆H₅BrN₂O₂S

Purity: >97.0%(T)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 249.08

Ref: 3B-B3829

5-Bromo-2-(methylthio)pyrimidine-carboxylic acid

CAS: 50593-92-5

Formula: C₆H₅BrN₂O₂S

Purity: 96%

Color and Shape: Solid, Crystalline Powder or Powder

Molecular weight: 249.08

Ref: 10-F049733

5-Bromo-2-methylsulfanyl-pyrimidine-4-carboxylic acid

CAS: 50593-92-5

5-Bromo-2-methylsulfanyl-pyrimidine-4-carboxylic acid is a pyrimidine derivative that inhibits protein kinases. The compound has been shown to inhibit the activity of protein kinase C, which is involved in mediating inflammatory responses, and phosphorylation of the insulin receptor substrate 1. 5-Bromo-2-methylsulfanyl-pyrimidine-4-carboxylic acid is an efficient inhibitor of kinases and can be used as a lead compound for the development of new compounds with therapeutic potential.

Formula: C₆H₅BrN₂O₂S

Purity: Min. 95%

Molecular weight: 249.09 g/mol

Ref: 3D-NB44268