CAS 50597-93-8

Isojacareubin

Description:

Isojacareubin, with the CAS number 50597-93-8, is a naturally occurring compound classified as a flavonoid. It is primarily derived from various plant sources, particularly those in the genus *Jacaranda*. Isojacareubin exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. The compound is characterized by its polyphenolic structure, which contributes to its ability to scavenge free radicals and modulate cellular signaling pathways. Isojacareubin is typically soluble in organic solvents and may have limited solubility in water, which is common for many flavonoids. Its stability can be influenced by factors such as pH and light exposure. Research into isoja-careubin's mechanisms of action and therapeutic potential is ongoing, highlighting its significance in natural product chemistry and medicinal applications.

Formula: C₁₈H₁₄O₆

InChI: InChI=1S/C18H14O6/c1-18(2)6-5-8-12(24-18)7-11(20)13-14(21)9-3-4-10(19)15(22)17(9)23-16(8)13/h3-7,19-20,22H,1-2H3

InChI key: InChIKey=FSTNFJKGRSHPBO-UHFFFAOYSA-N

SMILES: O=C1C2=C(C3=C(C=C2O)OC(C)(C)C=C3)OC=4C1=CC=C(O)C4O

Synonyms:

• 3H,7H-Pyrano[2,3-c]xanthen-7-one, 6,10,11-trihydroxy-3,3-dimethyl-
• Isojacareubin
• 6,10,11-Trihydroxy-3,3-dimethyl-3H,7H-pyrano[2,3-c]xanthen-7-one

Isojacareubin

CAS: 50597-93-8

Isojacareubin has double the H. pylori inhibition of amoxicillin, blocks PKC, and may help treat liver cancer.

Formula: C₁₈H₁₄O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 326.304

Ref: TM-TN4300

Isojacareubin

CAS: 50597-93-8

Formula: C₁₈H₁₄O₆

Purity: 95%~99%

Molecular weight: 326.304

Ref: BP-SBP03640

Isojacareubin

CAS: 50597-93-8

Isojacareubin is a natural compound classified as a prenylated xanthone. It is derived from certain plant species, particularly from the family Hypericaceae, known for their rich presence of bioactive xanthones. The mode of action of isojacareubin involves modulation of various biological pathways, including antioxidative, anti-inflammatory, and anticancer activities. This compound exhibits its effects by interfering with cellular signaling cascades and promoting apoptosis in cancerous cells, thereby inhibiting their proliferation.

Formula: C₁₈H₁₄O₆

Purity: Min. 95%

Molecular weight: 326.3 g/mol

Ref: 3D-ACA59793