CymitQuimica logo

CAS 50598-28-2

:

N-[3-(Dimethylamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonamide

Description:
N-[3-(Dimethylamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonamide is a fluorinated sulfonamide compound characterized by its unique structure, which includes a long perfluorinated carbon chain and a dimethylamino group. This compound exhibits properties typical of sulfonamides, such as potential antimicrobial activity, while the presence of fluorinated groups enhances its hydrophobicity and stability. The fluorinated carbon chain contributes to its unique surface activity, making it useful in applications such as surfactants or in the formulation of specialty chemicals. Additionally, the dimethylamino group may impart basicity, influencing its solubility and reactivity in various solvents. The compound's CAS number, 50598-28-2, allows for easy identification in chemical databases. Overall, this substance is notable for its complex structure and potential applications in fields such as pharmaceuticals, materials science, and chemical synthesis. However, handling and usage should be approached with caution due to the environmental and health implications associated with fluorinated compounds.
Formula:C11H13F13N2O2S
InChI:InChI=1S/C11H13F13N2O2S/c1-26(2)5-3-4-25-29(27,28)11(23,24)9(18,19)7(14,15)6(12,13)8(16,17)10(20,21)22/h25H,3-5H2,1-2H3
InChI key:InChIKey=INDOGKYZYLAGEM-UHFFFAOYSA-N
SMILES:C(C(C(S(NCCCN(C)C)(=O)=O)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F
Synonyms:
  • 1-Hexanesulfonamide, N-(3-(dimethylamino)propyl)-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-
  • N-(3-(Dimethylamino)propyl)tridecafluoro-1-hexanesulfonamide
  • N-[3-(Dimethylamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonamide
  • N-[3-(dimethylamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonamide
  • N-(3-(Dimethylamino)propyl)tridecafluorohexanesulphonamide
Found 7 products.