CAS 506-45-6
:22-hydroxydocosanoic acid
Description:
22-Hydroxydocosanoic acid, also known as behenic acid or docosanoic acid, is a long-chain fatty acid characterized by a straight-chain hydrocarbon structure with a hydroxyl group at the 22nd carbon position. This compound typically appears as a white, waxy solid at room temperature and is insoluble in water but soluble in organic solvents. Its molecular formula is C22H44O3, indicating the presence of a hydroxyl functional group, which imparts unique properties compared to other fatty acids. The hydroxyl group contributes to its potential applications in various fields, including cosmetics, where it is used as an emollient and thickening agent. Additionally, 22-hydroxydocosanoic acid can be involved in the synthesis of surfactants and other chemical intermediates. Its fatty acid chain length also suggests potential uses in the production of biodiesel and as a lubricant. Overall, the unique structure and properties of 22-hydroxydocosanoic acid make it a compound of interest in both industrial and research applications.
Formula:C22H44O3
InChI:InChI=1/C22H44O3/c23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22(24)25/h23H,1-21H2,(H,24,25)
SMILES:C(CCCCCCCCCCC(=O)O)CCCCCCCCCCO
Synonyms:- Docosanoic Acid, 22-Hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
22-Hydroxydocosanoic acid (ω-Hydroxybehenic acid)
CAS:Formula:C22H44O3Purity:98%Color and Shape:SolidMolecular weight:356.583022-Hydroxydocosanoic acid
CAS:Formula:C22H44O3Purity:>98%Color and Shape:SolidMolecular weight:356.5822-Hydroxydocosanoic Acid
CAS:Controlled ProductFormula:C22H44O3Color and Shape:NeatMolecular weight:356.58322-hydroxy Docosanoic Acid
CAS:22-Hydroxy docosanoic acid, a hydroxylated fatty acid identified within the suberin component of silver birch (B. pendula) outer bark, along with the leaves, roots, and wood of Q. ilex from Cala Violina and Colognole, Italy. [Matreya, LLC. Catalog No. 1818]Formula:C22H44O3Color and Shape:SolidMolecular weight:356.591




