CAS 50603-71-9: methyl 2-oxo-2H-cyclohepta[b]furan-3-carboxylate

Description:Methyl 2-oxo-2H-cyclohepta[b]furan-3-carboxylate, with the CAS number 50603-71-9, is a chemical compound characterized by its unique bicyclic structure that incorporates a furan ring fused to a cycloheptane framework. This compound features a carbonyl group (ketone) and an ester functional group, which contribute to its reactivity and potential applications in organic synthesis. The presence of the methyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions. Methyl 2-oxo-2H-cyclohepta[b]furan-3-carboxylate is of interest in medicinal chemistry and materials science due to its potential biological activity and utility as an intermediate in the synthesis of more complex molecules. Its structural characteristics may also influence its physical properties, such as boiling point and melting point, although specific values would depend on experimental conditions. Overall, this compound exemplifies the diverse chemistry associated with cyclic compounds and their derivatives.

Formula:C₁₁H₈O₄

InChI:InChI=1/C11H8O4/c1-14-10(12)9-7-5-3-2-4-6-8(7)15-11(9)13/h2-6H,1H3

Synonyms:
2H-cyclohepta[b]furan-3-carboxylic acid, 2-oxo-, methyl ester
Methyl 2-oxo-2H-cyclohepta[b]furan-3-carboxylate

Found 5 products.

Product data	Purity	Price range	Estimated delivery
3-(Methoxycarbonyl)-2H-cyclohepta[b]furan-2-one REF: 3B-M1188CAS: 50603-71-9	>98.0%(GC)	122.00 €	Thu 10 Apr 25
Methyl 2-oxo-2H-cyclohepta[b]furan-3-carboxylate REF: IN-DA003RP1CAS: 50603-71-9	98.0%	133.00 €	Thu 17 Apr 25
3-(Methoxycarbonyl)-2H-Cyclohepta[B]Furan-2-One REF: 54-OR1029391CAS: 50603-71-9	98%	32.00 €~1,758.00 €	Mon 21 Apr 25
Methyl 2-oxo-2H-cyclohepta[b]furan-3-carboxylate REF: 10-F222657CAS: 50603-71-9	95.0%	To inquire	Tue 29 Apr 25
3-(Methoxycarbonyl)-2H-cyclohepta[b]furan-2-one REF: 3D-FM75358CAS: 50603-71-9	Min. 95%	- - -	Discontinued product