CAS 50606-31-0

Methyl piperazine-1-carboxylate

Description:

Methyl piperazine-1-carboxylate is a chemical compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features a carboxylate functional group, contributing to its polar nature and potential solubility in polar solvents. It typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. Methyl piperazine-1-carboxylate is known for its applications in organic synthesis, particularly in the pharmaceutical industry, where it may serve as an intermediate in the production of various bioactive compounds. The presence of the methyl group enhances its reactivity and can influence its biological activity. Additionally, it may exhibit basic properties due to the nitrogen atoms in the piperazine ring, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential hazards associated with its use.

Formula: C₆H₁₂N₂O₂

InChI: InChI=1/C6H12N2O2/c1-10-6(9)8-4-2-7-3-5-8/h7H,2-5H2,1H3

SMILES: COC(=O)N1CCNCC1

Synonyms:

• 1-Piperazinecarboxylic acid, methyl ester
• Methylpiperazine-1-carboxyate

METHYL PIPERAZINE-1-CARBOXYLATE

CAS: 50606-31-0

Formula: C₆H₁₂N₂O₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 144.1717

Ref: IN-DA0037SD

Methyl piperazine-1-carboxylate

CAS: 50606-31-0

Methyl piperazine-1-carboxylate

Formula: C₆H₁₂N₂O₂

Purity: 98%

Color and Shape: colourless liquid

Molecular weight: 144.17g/mol

Ref: 54-OR313091

Methylpiperazine-1-carboxylate

CAS: 50606-31-0

Formula: C₆H₁₂N₂O₂

Purity: 98%

Color and Shape: Liquid, Clear

Molecular weight: 144.174

Ref: 10-F023252

1-(Methoxycarbonyl)piperazine-d8

Controlled Product

CAS: 50606-31-0

Formula: C₆D₈H₄N₂O₂

Color and Shape: Neat

Molecular weight: 152.221

Ref: TR-M261647