CAS 50606-33-2
:Phenyl 1-piperazinecarboxylate
Description:
Phenyl 1-piperazinecarboxylate, with the CAS number 50606-33-2, is an organic compound characterized by its piperazine and carboxylate functional groups. It typically appears as a white to off-white solid and is soluble in various organic solvents, which makes it useful in chemical synthesis and pharmaceutical applications. The compound features a phenyl group attached to a piperazine ring, which contributes to its potential biological activity. Piperazine derivatives are known for their diverse pharmacological properties, including anxiolytic and antidepressant effects. The carboxylate moiety can enhance the compound's reactivity and solubility, influencing its interactions in biological systems. Due to its structural characteristics, Phenyl 1-piperazinecarboxylate may serve as a precursor or intermediate in the synthesis of more complex molecules in medicinal chemistry. As with many chemical substances, safety and handling precautions should be observed, as it may pose health risks if ingested or improperly handled.
Formula:C11H14N2O2
InChI:InChI=1S/C11H14N2O2/c14-11(13-8-6-12-7-9-13)15-10-4-2-1-3-5-10/h1-5,12H,6-9H2
InChI key:InChIKey=NENLIGJPMYKXNE-UHFFFAOYSA-N
SMILES:C(OC1=CC=CC=C1)(=O)N2CCNCC2
Synonyms:- 1-(Phenoxycarbonyl)piperazine
- 1-Piperazinecarboxylic acid, phenyl ester
- Phenyl 1-piperazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
