CAS 50609-01-3

4-(2-pyrrolidin-1-ylethoxy)aniline

Description:

4-(2-Pyrrolidin-1-ylethoxy)aniline, identified by its CAS number 50609-01-3, is an organic compound characterized by its aniline structure, which features an amino group (-NH2) attached to a benzene ring. The compound includes a pyrrolidine moiety, a five-membered nitrogen-containing ring, linked through an ethoxy group (-O-CH2-CH2-). This structure imparts specific properties such as potential solubility in polar solvents due to the presence of the ethoxy group and the amino functionality, which can engage in hydrogen bonding. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular interactions could be influenced by the steric and electronic effects of the pyrrolidine and ethoxy substituents. Additionally, the compound's stability, reactivity, and potential applications would depend on its specific functional groups and overall molecular conformation. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₈N₂O

InChI: InChI=1/C12H18N2O/c13-11-3-5-12(6-4-11)15-10-9-14-7-1-2-8-14/h3-6H,1-2,7-10,13H2

SMILES: C1CCN(C1)CCOc1ccc(cc1)N

Synonyms:

• 4-[2-(Pyrrolidin-1-yl)ethoxy]aniline
• Benzenamine, 4-[2-(1-pyrrolidinyl)ethoxy]-
• 4-[2-(1-pyrrolidinyl)ethoxy]-Benzenamine
• 4-(2-Pyrrolidinoethoxy)aniline

4-[2-(pyrrolidin-1-yl)ethoxy]aniline

CAS: 50609-01-3

Formula: C₁₂H₁₈N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 206.2841

Ref: IN-DA00D9J9

4-(2-(Pyrrolidin-1-yl)ethoxy)aniline

CAS: 50609-01-3

4-(2-(Pyrrolidin-1-yl)ethoxy)aniline

Purity: 95%

Molecular weight: 206.28g/mol

Ref: 54-OR302272

4-(2-Pyrrolidin-1-yl-ethoxy)-phenylamine

CAS: 50609-01-3

Formula: C₁₂H₁₈N₂O

Purity: 98%

Color and Shape: Liquid

Molecular weight: 206.289

Ref: 10-F037343

Fedratinib Impurity 1

CAS: 50609-01-3

Formula: C₁₂H₁₈N₂O

Molecular weight: 206.29

Ref: ST-EA-CP-F57006