CAS 50611-86-4

Coelenteramide

Description:

Coelenteramide is a chemical compound classified as a marine natural product, primarily derived from certain species of marine organisms, particularly coelenterates. It is known for its unique structure, which includes a bicyclic framework that contributes to its biological activity. Coelenteramide exhibits fluorescence properties, making it of interest in various biochemical applications, including studies of cellular processes and as a potential marker in fluorescence microscopy. The compound has been investigated for its potential pharmacological properties, including antimicrobial and anticancer activities, although further research is necessary to fully understand its mechanisms and therapeutic potential. Its solubility characteristics can vary, influencing its behavior in biological systems. As with many natural products, the extraction and purification processes can be complex, requiring specific methodologies to isolate coelenteramide effectively. Overall, coelenteramide represents a fascinating area of study within marine chemistry and natural product research, highlighting the diverse chemical diversity found in marine ecosystems.

Formula: C₂₅H₂₁N₃O₃

InChI: InChI=1S/C25H21N3O3/c29-20-10-6-18(7-11-20)15-24(31)28-25-22(14-17-4-2-1-3-5-17)27-23(16-26-25)19-8-12-21(30)13-9-19/h1-13,16,29-30H,14-15H2,(H,26,28,31)

InChI key: InChIKey=CJIIERPDFZUYPI-UHFFFAOYSA-N

SMILES: C(C=1C(NC(CC2=CC=C(O)C=C2)=O)=NC=C(N1)C3=CC=C(O)C=C3)C4=CC=CC=C4

Synonyms:

• 2-(p-Hydroxyphenylacetyl)amino-3-benzyl-5-(p-hydroxyphenyl)pyrazine
• 2-(p-Hydroxyphenylacetamido)-3-benzyl-5-(p-hydroxyphenyl)pyrazine
• Benzeneacetamide, 4-hydroxy-N-[5-(4-hydroxyphenyl)-3-(phenylmethyl)pyrazinyl]-
• 4-Hydroxy-N-[5-(4-hydroxyphenyl)-3-(phenylmethyl)-2-pyrazinyl]benzeneacetamide
• Benzeneacetamide, 4-hydroxy-N-[5-(4-hydroxyphenyl)-3-(phenylmethyl)-2-pyrazinyl]-

Coelenteramide

CAS: 50611-86-4

Coelenteramide, an oxidative derivative of Coelenterazine, forms a complex with apoAequorin/Ca2+ known as blue fluorescent protein (BFP), exhibiting continuous

Formula: C₂₅H₂₁N₃O₃

Color and Shape: Solid

Molecular weight: 411.45

Ref: TM-T82697