CAS 50616-43-8

{[5-(2-propoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl}acetic acid

Description:

The chemical substance known as {[5-(2-propoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl}acetic acid, with the CAS number 50616-43-8, is characterized by its unique structural features that include a triazole ring and a sulfanyl group. This compound typically exhibits properties associated with both triazoles and carboxylic acids, such as potential biological activity and solubility in polar solvents. The presence of the propoxyphenyl group may enhance its lipophilicity, influencing its interaction with biological membranes. As a triazole derivative, it may also exhibit fungicidal or antimicrobial properties, making it of interest in agricultural and pharmaceutical applications. The sulfanyl group can contribute to its reactivity and potential for forming disulfide bonds, which may be relevant in biochemical contexts. Overall, this compound's characteristics suggest it could serve as a valuable lead compound for further research in medicinal chemistry and agrochemicals.

Formula: C₁₃H₁₅N₃O₃S

InChI: InChI=1/C13H15N3O3S/c1-2-7-19-10-6-4-3-5-9(10)12-14-13(16-15-12)20-8-11(17)18/h3-6H,2,7-8H2,1H3,(H,17,18)(H,14,15,16)

{[5-(2-propoxyphenyl)-4H-1,2,4-triazol-3-yl]thio}acetic acid

CAS: 50616-43-8

Formula: C₁₃H₁₅N₃O₃S

Purity: 95.0%

Molecular weight: 293.34

Ref: 10-F314458