CymitQuimica logo

CAS 50617-73-7

:

N1-Methylbenzene-1,3-diamine

Description:
N1-Methylbenzene-1,3-diamine, also known as 3-Amino-N-methyl-aniline, is an organic compound characterized by the presence of an amino group (-NH2) and a methyl group (-CH3) attached to a benzene ring. This compound features two amino groups positioned at the 1 and 3 positions of the benzene ring, contributing to its classification as a diamine. It is typically a solid at room temperature and may exhibit a range of physical properties, including solubility in organic solvents. The presence of amino groups makes it a potential candidate for various chemical reactions, including those involving nucleophilic substitution and coupling reactions, which are valuable in the synthesis of dyes, pharmaceuticals, and polymers. Additionally, due to the presence of amine groups, it may exhibit basic properties and can participate in hydrogen bonding. Safety considerations are important when handling this compound, as it may pose health risks, including skin and respiratory irritation. Proper safety protocols should be followed to mitigate exposure risks.
Formula:C7H10N2
InChI:InChI=1S/C7H10N2/c1-9-7-4-2-3-6(8)5-7/h2-5,9H,8H2,1H3
InChI key:DYNWNNKAUGBOOZ-UHFFFAOYSA-N
SMILES:CNC1=CC=CC(=C1)N
Found 4 products.