CAS 50622-09-8: (4S,5S)-2,2-Dimethyl-1,3-dioxolane-4,5-dimethanol
Description:(4S,5S)-2,2-Dimethyl-1,3-dioxolane-4,5-dimethanol is a chemical compound characterized by its unique dioxolane ring structure, which features two hydroxymethyl groups at the 4 and 5 positions and two methyl groups at the 2 position. This compound is a chiral molecule, with specific stereochemistry denoted by the (4S,5S) configuration, indicating the spatial arrangement of its atoms. The presence of the dioxolane ring contributes to its stability and reactivity, making it a potential candidate for various chemical reactions, including those in organic synthesis. The hydroxymethyl groups enhance its solubility in polar solvents and may participate in hydrogen bonding, influencing its physical properties such as boiling point and melting point. Additionally, the compound's structure suggests potential applications in pharmaceuticals or as intermediates in organic synthesis due to the functional groups present. Overall, (4S,5S)-2,2-Dimethyl-1,3-dioxolane-4,5-dimethanol is notable for its stereochemistry and functional versatility in chemical reactions.
Formula:C7H14O4
InChI:InChI=1S/C7H14O4/c1-7(2)10-5(3-8)6(4-9)11-7/h5-6,8-9H,3-4H2,1-2H3/t5-,6-/m0/s1
InChI key:InChIKey=INVRLGIKFANLFP-WDSKDSINSA-N
SMILES:OCC1OC(OC1CO)(C)C
- Synonyms:
- (+)-2,3-O-Isopropylidene-<span class="text-smallcaps">L</span>-threitol
- (+)-2,3-O-Isopropylidene-L-Threitol
- (2,2-Dimethyl-1,3-dioxolane-4,5-diyl)dimethanol
- (4S,5S)-2,2-Dimethyl-1,3-dioxolane-4,5-dimethanol
- (4S,5S)-4,5-Bis(hydroxymethyl)-2,2-dimethyl-1,3-dioxolane
- 1,3-Dioxolane-4,5-Dimethanol, 2,2-Dimethyl-
- 1,3-Dioxolane-4,5-dimethanol, 2,2-dimethyl-, (4S,5S)-
- 1,3-Dioxolane-4,5-dimethanol, 2,2-dimethyl-, (4S-trans)-
- 256-658-6
- [(4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-diyl]dimethanol
- See more synonyms
