CAS 50622-10-1
:(S,S)-(-)-1,4-dimethoxy-2,3-butanediol
Description:
(S,S)-(-)-1,4-dimethoxy-2,3-butanediol, with the CAS number 50622-10-1, is a chiral organic compound characterized by its specific stereochemistry, which contributes to its unique chemical properties and potential applications. This compound features two methoxy groups and two hydroxyl groups, making it a diol. Its structure allows for hydrogen bonding, which can influence its solubility in polar solvents and its reactivity in various chemical reactions. The presence of the methoxy groups enhances its hydrophobic characteristics while still allowing for some degree of polarity due to the hydroxyl groups. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and organic synthesis. Additionally, its chirality can lead to different interactions in biological systems, which is crucial for drug development. Overall, (S,S)-(-)-1,4-dimethoxy-2,3-butanediol is a versatile compound with potential applications in pharmaceuticals and organic synthesis, driven by its unique structural features and stereochemical properties.
Formula:C6H14O4
InChI:InChI=1/C6H14O4/c1-9-3-5(7)6(8)4-10-2/h5-8H,3-4H2,1-2H3/t5-,6-/m0/s1
SMILES:COC[C@@H]([C@H](COC)O)O
Synonyms:- (2S,3S)-1,4-dimethoxybutane-2,3-diol
- (S,S)-(?-1,4-Dimethoxy-2,3-butanediol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(S,S)-(-)-1,4-Dimethoxy-2,3-butanediol
CAS:(S,S)-(-)-1,4-Dimethoxy-2,3-butanediol is an organic compound with the chemical formula CH(OCH)CHOH. This colorless liquid is a chiral molecule that can exist in two enantiomeric forms. The asymmetric carbon atom (C-1) is of high stereoselectivity and has been shown to undergo nucleophilic attack by a wide variety of nucleophiles. The reaction product can be either the corresponding enolate or enolates depending on whether the nucleophile is a base or acid. In addition, this compound yields a stereoselective synthesis of chiral products when reacted with carbonyls.Formula:C6H14O4Purity:Min. 95%Molecular weight:150.17 g/mol

