CAS 50652-78-3
:Methyl 4-methyl-2-pentenoate
Description:
Methyl 4-methyl-2-pentenoate, with the CAS number 50652-78-3, is an organic compound classified as an ester. It is characterized by its molecular structure, which includes a methyl group, a pentenoate backbone, and a double bond in the carbon chain, contributing to its unsaturation. This compound typically appears as a colorless to pale yellow liquid with a fruity odor, making it potentially useful in flavor and fragrance applications. Methyl 4-methyl-2-pentenoate is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. Its reactivity is influenced by the presence of the double bond, allowing it to participate in various chemical reactions, such as polymerization and addition reactions. Additionally, it may exhibit moderate volatility and can be flammable under certain conditions. Safety precautions should be taken when handling this compound, as it may cause irritation to the skin and eyes. Overall, methyl 4-methyl-2-pentenoate is a versatile compound with applications in organic synthesis and the chemical industry.
Formula:C7H12O2
InChI:InChI=1/C7H12O2/c1-6(2)4-5-7(8)9-3/h4-6H,1-3H3/b5-4+
Synonyms:- 4-Methyl-2-pentenoic acid methyl ester
- methyl (2E)-4-methylpent-2-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 4-methyl-2-pentenoate
CAS:<p>Methyl 4-methyl-2-pentenoate is an amide that can be synthesized from propanamide and an α,β-unsaturated carbonyl compound. It has a chiral center and is therefore optically active. The enolates of methyl 4-methyl-2-pentenoate are more reactive than the corresponding esters because the enolate anion is a better leaving group. This reactivity difference is due to the fact that the attack of nucleophiles on the ester carbon atom is sterically hindered by the substituent group, whereas attack on the enolate carbon atom is not hindered. Methyl 4-methyl-2-pentenoate also reacts with electrophilic reagents to form addition products, such as β-unsaturated esters and amides.</p>Formula:C7H12O2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:128.17 g/mol
