CAS 50656-65-0

Rotundifuran

Description:

Rotundifuran, with the CAS number 50656-65-0, is a naturally occurring organic compound classified as a furan derivative. It is primarily extracted from various plant sources, particularly from the genus *Cinnamomum*. This compound is characterized by its unique bicyclic structure, which includes a furan ring fused to a cyclopentane ring. Rotundifuran is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmacological research. It is typically a colorless to pale yellow liquid with a distinctive odor, and it is soluble in organic solvents. The compound's reactivity is influenced by the presence of functional groups in its structure, allowing it to participate in various chemical reactions. Additionally, rotundifuran's stability and behavior under different conditions can vary, which is important for its applications in both natural product chemistry and potential therapeutic uses. Overall, rotundifuran represents a fascinating subject of study due to its natural origins and promising biological activities.

Formula: C₂₂H₃₄O₄

InChI: InChI=1S/C22H34O4/c1-15-13-18(26-16(2)23)19-20(3,4)9-6-10-21(19,5)22(15,24)11-7-17-8-12-25-14-17/h8,12,14-15,18-19,24H,6-7,9-11,13H2,1-5H3/t15-,18-,19+,21+,22-/m1/s1

InChI key: InChIKey=QKHCQFQIJKXMOE-UGFIEOPBSA-N

SMILES: C[C@]12[C@@]([C@H](OC(C)=O)C[C@@H](C)[C@@]1(CCC=3C=COC3)O)(C(C)(C)CCC2)[H]

Synonyms:

• 1,4-Naphthalenediol, 1-[2-(3-furanyl)ethyl]decahydro-2,5,5,8a-tetramethyl-, 4-acetate, (1R,2R,4R,4aS,8aS)-
• Rotundifuran
• 1,4-Naphthalenediol, 1-[2-(3-furanyl)ethyl]decahydro-2,5,5,8a-tetramethyl-, 4-acetate, [1R-(1α,2α,4β,4aα,8aβ)]-

Rotundifuran

CAS: 50656-65-0

Rotundifuran

Purity: ≥98%

Molecular weight: 362.5g/mol

Ref: 54-BUP21384

Rotundifuran

CAS: 50656-65-0

Formula: C₂₂H₃₄O₄

Molecular weight: 362.51

Ref: 7W-GY3043

Rotundifuran

CAS: 50656-65-0

Formula: C₂₂H₃₄O₄

Purity: 95%~99%

Molecular weight: 362.51

Ref: BP-BP4408

Rotundifuran

CAS: 50656-65-0

Rotundifuran is a natural diterpene compound, which is primarily isolated from the medicinal plant *Vitex agnus-castus*, commonly known as chaste tree. This compound’s unique structure and origin make it a topic of interest in pharmacological research, particularly for its potential therapeutic properties.

Formula: C₂₂H₃₄O₄

Purity: Min. 95%

Molecular weight: 362.5 g/mol

Ref: 3D-ACA65665

Rotundifuran

CAS: 50656-65-0

Rotundifuran from Vitex rotundifolia fruit blocks cell cycle, induces apoptosis in leukemia cells.

Formula: C₂₂H₃₄O₄

Purity: 99.82%

Color and Shape: Solid

Molecular weight: 362.5

Ref: TM-T34398