CAS 50656-77-4: Niranthin
Description:Niranthin, with the CAS number 50656-77-4, is a naturally occurring chemical compound primarily derived from the plant species *Naringi crenulata*. It belongs to the class of flavonoids, which are known for their diverse biological activities. Niranthin exhibits antioxidant properties, which can help in neutralizing free radicals and reducing oxidative stress in biological systems. Additionally, it has been studied for its potential anti-inflammatory and antimicrobial effects, making it of interest in pharmacological research. The compound is typically characterized by its specific molecular structure, which includes multiple hydroxyl groups that contribute to its reactivity and solubility in various solvents. Niranthin's applications may extend to traditional medicine and dietary supplements, although further research is needed to fully understand its efficacy and safety in therapeutic contexts. As with many natural products, the extraction and purification processes can influence its availability and concentration in formulations.
Formula:C24H32O7
InChI:InChI=1S/C24H32O7/c1-25-13-18(8-16-6-7-20(27-3)21(10-16)28-4)19(14-26-2)9-17-11-22(29-5)24-23(12-17)30-15-31-24/h6-7,10-12,18-19H,8-9,13-15H2,1-5H3/t18-,19-/m1/s1
InChI key:InChIKey=RCFGIEPQSDGMJJ-RTBURBONSA-N
SMILES:O(C1=CC=C(C=C1OC)CC(COC)C(COC)CC2=CC(OC)=C3OCOC3=C2)C
- Synonyms:
- 1,3-Benzodioxole,6-[4-(3,4-dimethoxyphenyl)-2,3-bis(methoxymethyl)butyl]-4-methoxy-, (R*,R*)-
- Niranthin
- rel-6-[(2R,3R)-4-(3,4-Dimethoxyphenyl)-2,3-bis(methoxymethyl)butyl]-4-methoxy-1,3-benzodioxole
- 1,3-Benzodioxole, 6-[(2R,3R)-4-(3,4-dimethoxyphenyl)-2,3-bis(methoxymethyl)butyl]-4-methoxy-, rel-
