CAS 50656-78-5
:Nirtetralin
Description:
Nirtetralin, with the CAS number 50656-78-5, is a chemical compound that belongs to the class of nitro-substituted aromatic compounds. It is characterized by its complex molecular structure, which includes multiple aromatic rings and nitro groups. Nirtetralin is typically a solid at room temperature and may exhibit a range of physical properties such as color and solubility depending on its specific formulation and purity. The compound is known for its potential applications in various fields, including pharmaceuticals and materials science, due to its unique electronic and chemical properties. It may also exhibit specific reactivity patterns typical of nitro compounds, such as undergoing reduction or substitution reactions under certain conditions. Safety data sheets and regulatory information should be consulted for handling and storage guidelines, as nitro compounds can pose health and environmental risks. Overall, Nirtetralin represents a significant area of interest in chemical research and industrial applications.
Formula:C24H30O7
InChI:InChI=1S/C24H30O7/c1-25-11-16-8-15-10-20-23(31-13-30-20)24(29-5)22(15)21(17(16)12-26-2)14-6-7-18(27-3)19(9-14)28-4/h6-7,9-10,16-17,21H,8,11-13H2,1-5H3/t16-,17-,21+/m1/s1
InChI key:InChIKey=LHQDZANQXMRHIV-LZJOCLMNSA-N
SMILES:O(C)C=1C=2[C@H]([C@H](COC)[C@@H](COC)CC2C=C3C1OCO3)C4=CC(OC)=C(OC)C=C4
Synonyms:- (5R,6S,7S)-5-(3,4-Dimethoxyphenyl)-5,6,7,8-tetrahydro-4-methoxy-6,7-bis(methoxymethyl)naphtho[2,3-d]-1,3-dioxole
- Naphtho(2,3-d)-1,3-dioxole, 5-(3,4-dimethoxyphenyl)-5,6,7,8-tetrahydro-4-methoxy-6,7-bis(methoxymethyl)-, (5R,6S,7S)-rel-
- Naphtho[2,3-d]-1,3-dioxole, 5-(3,4-dimethoxyphenyl)-5,6,7,8-tetrahydro-4-methoxy-6,7-bis(methoxymethyl)-, (5R,6S,7S)-
- Naphtho[2,3-d]-1,3-dioxole, 5-(3,4-dimethoxyphenyl)-5,6,7,8-tetrahydro-4-methoxy-6,7-bis(methoxymethyl)-, (5α,6β,7α)-(+)-
- Nirtetralin
- (5R,6S,7S)-5-(3′,4′-Dimethoxyphenyl)-4-methoxy-6,7-bis(methoxymethyl)-5,6,7,8-tetrahydronaphtho[2,3-d][1′′,3′′]dioxole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Nirtetralin
CAS:Nirtetralin is a lignan with an inhibitory effect on the binding of receptor to its ligand, which is found in plants such as phyllanthus and niranthin. It has been shown to have potent inhibition of insulin resistance in K562 cells, an effect that may be due to changes in mitochondrial membrane potential. Nirtetralin also inhibits the ATPase activity of hexane-insensitive, liver-type pyruvate dehydrogenase kinase, which is involved in the regulation of hepatic glucose production and lipid metabolism. Nirtetralin has been shown to have anti-inflammatory effects by inhibiting the production of pro-inflammatory cytokines and lipopolysacharide (LPS) induced nitric oxide production from macrophages.
Formula:C24H30O7Purity:Min. 95%Molecular weight:430.5 g/molRef: 3D-ACA65678
Discontinued product



