CAS 50673-96-6
:Dopamine quinone
Description:
Dopamine quinone is a reactive intermediate derived from the oxidation of dopamine, a neurotransmitter involved in various physiological functions. It is characterized by its quinone structure, which includes a six-membered aromatic ring with two carbonyl groups. This compound is known for its electrophilic properties, allowing it to readily react with nucleophiles, including proteins and other biomolecules, which can lead to modifications in cellular components. Dopamine quinone plays a significant role in neurobiology, particularly in the context of neurodegenerative diseases, as it can contribute to oxidative stress and cellular damage. Its formation is often associated with the pathological processes in conditions such as Parkinson's disease. Additionally, dopamine quinone can participate in redox reactions, influencing cellular signaling pathways. Due to its reactivity, it is important to study dopamine quinone in the context of both its biological implications and potential therapeutic applications, as understanding its behavior can provide insights into the mechanisms of neurotoxicity and neuroprotection.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5H,3-4,9H2
InChI key:InChIKey=PQPXZWUZIOASKS-UHFFFAOYSA-N
SMILES:C(CN)C1=CC(=O)C(=O)C=C1
Synonyms:- 3,5-Cyclohexadiene-1,2-dione, 4-(2-aminoethyl)-
- 4-(2-Aminoethyl)-3,5-cyclohexadiene-1,2-dione
- 4-Aminoethyl-1,2-benzoquinone
- Dopamine o-quinone
- Dopamine quinone
- o-Dopaminoquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
