CAS 50677-25-3

N'-(chloroacetyl)-4-methoxybenzohydrazide

Description:

N'-(Chloroacetyl)-4-methoxybenzohydrazide is a chemical compound characterized by its hydrazide functional group, which is linked to a chloroacetyl moiety and a methoxy-substituted aromatic ring. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the chloroacetyl group suggests reactivity that may facilitate further chemical modifications or interactions with biological targets. The methoxy group on the benzene ring can influence the compound's solubility and biological activity, often enhancing its lipophilicity. Additionally, the hydrazide structure may exhibit properties such as antimicrobial or anti-inflammatory activities, making it of interest in drug discovery. Safety and handling precautions should be observed due to the presence of the chloroacetyl group, which can be hazardous. Overall, N'-(chloroacetyl)-4-methoxybenzohydrazide represents a versatile scaffold for further chemical exploration and potential therapeutic applications.

Formula: C₁₀H₁₁ClN₂O₃

InChI: InChI=1/C10H11ClN2O3/c1-16-8-4-2-7(3-5-8)10(15)13-12-9(14)6-11/h2-5H,6H2,1H3,(H,12,14)(H,13,15)

SMILES: COc1ccc(cc1)C(=O)NN=C(CCl)O

N'-(2-Chloroacetyl)-4-methoxybenzohydrazide

CAS: 50677-25-3

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClN₂O₃

Purity: Min. 95%

Molecular weight: 242.66 g/mol

Ref: 3D-ACA67725