CAS 50678-27-8
:1,2,3,4,6-pentakis-O-(3,4,5-trihydroxybenzoyl)-D-glucopyranose
Description:
1,2,3,4,6-Pentakis-O-(3,4,5-trihydroxybenzoyl)-D-glucopyranose is a complex glycoside derived from D-glucopyranose, characterized by the presence of multiple hydroxyl groups and a specific benzoyl substituent. This compound features five benzoyl groups attached to the hydroxyl positions of the glucose molecule, which significantly enhances its solubility and reactivity. The trihydroxybenzoyl moiety contributes to its potential antioxidant properties, making it of interest in various biochemical applications. The presence of multiple hydroxyl groups also suggests that this compound may exhibit strong hydrogen bonding capabilities, influencing its physical properties such as melting point and solubility in polar solvents. Additionally, due to its structural complexity, it may interact with biological systems, potentially affecting metabolic pathways or serving as a precursor in synthetic chemistry. Overall, this compound exemplifies the intricate relationship between structure and function in carbohydrate chemistry, with implications for both natural product chemistry and pharmaceutical development.
Formula:C41H32O26
InChI:InChI=1/C41H32O26/c42-17-1-12(2-18(43)28(17)52)36(57)62-11-27-33(64-37(58)13-3-19(44)29(53)20(45)4-13)34(65-38(59)14-5-21(46)30(54)22(47)6-14)35(66-39(60)15-7-23(48)31(55)24(49)8-15)41(63-27)67-40(61)16-9-25(50)32(56)26(51)10-16/h1-10,27,33-35,41-56H,11H2/t27-,33-,34+,35-,41?/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,2,3,4,6-Penta-O-galloyl-D-glucopyranose
CAS:1,2,3,4,6-Penta-O-galloyl-D-glucopyranose (PGG) is a naturally occurring compound that has been shown to be involved in the transport of glucose across cell membranes. It increases the blood glucose levels in animals and is an inhibitor of phosphatase. PGG has also been shown to have potential therapeutic properties for diabetes. Studies have shown that PGG inhibits the enzymes involved in glycogen synthesis and glycogenolysis, which are important for maintaining normal blood glucose levels. This inhibition may be due to its affinity for receptor binding sites or its ability to act as a competitive inhibitor of these enzymes.Formula:C41H32O26Purity:Min. 95%Molecular weight:940.68 g/mol
