CAS 50691-20-8
:4-(4-Chlorophenyl)-5-[(dimethylamino)methylene]-2,5-dihydro-2-oxo-3-furancarbonitrile
Description:
4-(4-Chlorophenyl)-5-[(dimethylamino)methylene]-2,5-dihydro-2-oxo-3-furancarbonitrile, with CAS number 50691-20-8, is a synthetic organic compound characterized by its complex structure, which includes a furan ring, a carbonitrile group, and a dimethylamino substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the carbonitrile and the dimethylamino moiety. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The chlorophenyl group can influence its electronic properties and interactions, potentially enhancing its efficacy in biological systems. Additionally, the compound's stability and reactivity can be affected by environmental conditions, such as pH and temperature. Overall, this substance represents a class of compounds that may have diverse applications in medicinal chemistry and material science.
Formula:C14H11ClN2O2
InChI:InChI=1S/C14H11ClN2O2/c1-17(2)8-12-13(11(7-16)14(18)19-12)9-3-5-10(15)6-4-9/h3-6,8H,1-2H3
InChI key:InChIKey=WVPVOFWFIWRJMZ-UHFFFAOYSA-N
SMILES:C(N(C)C)=C1C(=C(C#N)C(=O)O1)C2=CC=C(Cl)C=C2
Synonyms:- 3-Furancarbonitrile, 4-(4-chlorophenyl)-5-[(dimethylamino)methylene]-2,5-dihydro-2-oxo-
- 4-(4-Chlorophenyl)-5-[(dimethylamino)methylene]-2,5-dihydro-2-oxo-3-furancarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(5E)-4-(4-Chlorophenyl)-5-[(dimethylamino)methylidene]-2-oxo-2,5-dihydrofuran-3-carbonitrile
CAS:(5E)-4-(4-Chlorophenyl)-5-[(dimethylamino)methylidene]-2-oxo-2,5-dihydrofuran-3-carbonitrilePurity:techMolecular weight:274.70g/mol
