CAS 50699-50-8

phenyl (3-chlorophenyl)carbamate

Description:

Phenyl (3-chlorophenyl)carbamate, with the CAS number 50699-50-8, is an organic compound characterized by the presence of a carbamate functional group attached to a phenyl ring and a 3-chlorophenyl substituent. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including agrochemicals and pharmaceuticals. The presence of the chlorophenyl group can influence its chemical reactivity and biological activity, often enhancing its efficacy in specific applications. Phenyl (3-chlorophenyl)carbamate may exhibit moderate solubility in organic solvents, while its solubility in water can be limited due to its hydrophobic nature. The compound's stability and reactivity can be affected by environmental factors such as pH and temperature. As with many carbamates, it may also be subject to hydrolysis under certain conditions, leading to the release of amines and carbon dioxide. Safety data should be consulted for handling and exposure guidelines, as carbamates can exhibit varying degrees of toxicity.

Formula: C₁₃H₁₀ClNO₂

InChI: InChI=1/C13H10ClNO2/c14-10-5-4-6-11(9-10)15-13(16)17-12-7-2-1-3-8-12/h1-9H,(H,15,16)

SMILES: c1ccc(cc1)OC(=Nc1cccc(c1)Cl)O

phenyl N-(3-chlorophenyl)carbamate

CAS: 50699-50-8

Formula: C₁₃H₁₀ClNO₂

Purity: 98%

Molecular weight: 247.6770

Ref: IN-DA01BDTO

Phenyl (3-chlorophenyl)carbamate

CAS: 50699-50-8

Purity: 95+%

Molecular weight: 247.6799927

Ref: 10-F609318

Phenyl (3-Chlorophenyl)carbamate

Controlled Product

CAS: 50699-50-8

Formula: C₁₃H₁₀ClNO₂

Color and Shape: Neat

Molecular weight: 247.677

Ref: TR-P506990

Phenyl (3-Chlorophenyl)carbamate

CAS: 50699-50-8

Versatile small molecule scaffold

Formula: C₁₃H₁₀ClNO₂

Purity: Min. 95%

Molecular weight: 247.68 g/mol

Ref: 3D-ACA69950