CAS 50712-70-4

5-Chloro-2-methylbenzonitrile

Description:

5-Chloro-2-methylbenzonitrile, with the CAS number 50712-70-4, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom and a nitrile group. The presence of the chloro group at the 5-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow solid and is known for its moderate solubility in organic solvents. It exhibits a range of chemical reactivity due to the presence of the nitrile functional group, which can participate in nucleophilic addition reactions. Additionally, the chlorine atom can influence the compound's reactivity and stability, making it useful in various synthetic applications, particularly in the pharmaceutical and agrochemical industries. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 5-Chloro-2-methylbenzonitrile is a valuable compound in organic synthesis and research.

Formula: C₈H₆ClN

InChI: InChI=1/C8H6ClN/c1-6-2-3-8(9)4-7(6)5-10/h2-4H,1H3

SMILES: Cc1ccc(cc1C#N)Cl

5-Chloro-2-methylbenzonitrile

CAS: 50712-70-4

Formula: C₈H₆ClN

Purity: 96%

Color and Shape: Solid

Molecular weight: 151.5929

Ref: IN-DA003MNH

5-Chloro-2-methylbenzonitrile

CAS: 50712-70-4

5-Chloro-2-methylbenzonitrile

Purity: 99%

Molecular weight: 151.59g/mol

Ref: 54-OR345358

5-Chloro-2-methylbenzonitrile

CAS: 50712-70-4

Formula: C₈H₆ClN

Purity: >98.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 151.59

Ref: 3B-C3339

5-Chloro-2-methylbenzonitrile

CAS: 50712-70-4

Formula: C₈H₆ClN

Purity: 96%

Color and Shape: Solid, Beige powder

Molecular weight: 151.59

Ref: 10-F120305