CymitQuimica logo

CAS 5072-45-7

:

(2R,6S)-2,6-dimethylpiperidine hydrochloride

Description:
(2R,6S)-2,6-dimethylpiperidine hydrochloride is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This specific compound features two methyl groups attached to the second and sixth carbon atoms of the piperidine ring, contributing to its stereochemistry and influencing its biological activity. The presence of the hydrochloride indicates that it is in a salt form, which enhances its solubility in water and may improve its stability and handling properties. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its chiral nature, indicated by the (2R,6S) designation, suggests that it may exhibit specific pharmacological effects depending on its stereochemistry. Overall, (2R,6S)-2,6-dimethylpiperidine hydrochloride is of interest in various fields, including organic synthesis and drug development, due to its unique structural and chemical properties.
Formula:C7H16ClN
InChI:InChI=1/C7H15N.ClH/c1-6-4-3-5-7(2)8-6;/h6-8H,3-5H2,1-2H3;1H/t6-,7+;
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.