CAS 50727-04-3
:5-methoxy-1H-isoindole-1,3(2H)-dione
Description:
5-Methoxy-1H-isoindole-1,3(2H)-dione, also known as methoxyisoindole, is an organic compound characterized by its isoindole structure, which consists of a fused benzene and pyrrole ring. This compound features a methoxy group (-OCH3) at the 5-position and a dione functional group, indicating the presence of two carbonyl groups (C=O) within its molecular framework. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. The presence of the methoxy group can influence its solubility, making it more soluble in organic solvents compared to water. This compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities. Its reactivity can be attributed to the electrophilic nature of the carbonyl groups, which may participate in various chemical reactions. Additionally, the compound's structure allows for potential interactions with biological targets, making it a subject of research in drug development and synthetic chemistry.
Formula:C9H7NO3
InChI:InChI=1/C9H7NO3/c1-13-5-2-3-6-7(4-5)9(12)10-8(6)11/h2-4H,1H3,(H,10,11,12)
SMILES:COc1ccc2c(c1)C(=O)N=C2O
Synonyms:- 1H-Isoindole-1,3(2H)-dione, 5-methoxy-
- 5-Methoxy-1H-isoindol-1,3(2H)-dion
- 5-Methoxyisoindoline-1,3-Dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-methoxy-1h-isoindole-1,3(2h)-dione
CAS:Formula:C9H7NO3Purity:98%Color and Shape:SolidMolecular weight:177.15685-Methoxyisoindoline-1,3-dione
CAS:<p>5-Methoxyisoindoline-1,3-dione</p>Purity:99%Molecular weight:177.16g/mol5-Methoxyisoindoline-1,3-dione
CAS:Formula:C9H7NO3Purity:98%Color and Shape:No data available.Molecular weight:177.1595-Methoxyisoindoline-1,3-dione
CAS:<p>5-Methoxyisoindoline-1,3-dione is a hydroxycinnamic acid derivative that was first isolated in 1882 by the German chemist Adolf von Baeyer. It is produced by the oxidation of salicylaldehyde and has been used as a chemical intermediate. It has also been used as a therapeutic agent during World War I, but this use was discontinued due to its toxicity. 5-Methoxyisoindoline-1,3-dione is a potent inhibitor of mitosis and causes cell death in cells undergoing division. This compound is also an acetamido derivative of colchicine, which inhibits mitosis by binding to microtubules and inhibiting their polymerization.</p>Formula:C9H7NO3Purity:Min. 95%Molecular weight:177.16 g/mol



