CAS 50727-79-2
:3,3'-(propane-1,3-diyldisulfanediyl)bis(2-aminopropanoic acid) (non-preferred name)
Description:
3,3'-(Propane-1,3-diyldisulfanediyl)bis(2-aminopropanoic acid), also known by its non-preferred name and identified by the CAS number 50727-79-2, is a chemical compound characterized by its dual amino acid structure, specifically featuring two 2-aminopropanoic acid (or alanine) moieties linked by a propane-1,3-diyldisulfanediyl group. This compound contains sulfur atoms, which contribute to its unique properties, including potential antioxidant activity and the ability to form disulfide bonds. The presence of amino groups allows for interactions with various biological systems, making it of interest in biochemical and pharmaceutical applications. Its solubility in water is influenced by the amino acid components, while the disulfide linkage may affect its stability and reactivity. Overall, this compound exemplifies the complexity of amino acid derivatives and their potential roles in biological processes and synthetic chemistry.
Formula:C9H18N2O4S2
InChI:InChI=1/C9H18N2O4S2/c10-6(8(12)13)4-16-2-1-3-17-5-7(11)9(14)15/h6-7H,1-5,10-11H2,(H,12,13)(H,14,15)
SMILES:C(CSCC(C(=O)O)N)CSCC(C(=O)O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Fudosteine Impurity 15 DiHCl
CAS:Formula:C9H18N2O4S2·2HClColor and Shape:White To Off-White SolidMolecular weight:282.37 2*36.46
