CAS 50727-94-1
:3-Methyl-3-(4-methyl-3-penten-1-yl)-2-oxiranemethanol
Description:
3-Methyl-3-(4-methyl-3-penten-1-yl)-2-oxiranemethanol, with the CAS number 50727-94-1, is an organic compound characterized by its unique structure that includes an epoxide group and a hydroxyl group. This compound features a branched carbon chain, which contributes to its potential reactivity and physical properties. The presence of the epoxide functional group indicates that it may undergo ring-opening reactions, making it a versatile intermediate in organic synthesis. Additionally, the hydroxyl group suggests that it may exhibit hydrogen bonding, influencing its solubility and boiling point. The compound's molecular structure implies potential applications in the synthesis of more complex molecules, possibly in the fields of pharmaceuticals or agrochemicals. Its specific characteristics, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H18O2
InChI:InChI=1/C10H18O2/c1-8(2)5-4-6-10(3)9(7-11)12-10/h5,9,11H,4,6-7H2,1-3H3
InChI key:InChIKey=RZRBXGPSHVAUQO-UHFFFAOYSA-N
SMILES:C(CC=C(C)C)C1(C)C(CO)O1
Synonyms:- [3-Methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methanol
- [3-methyl-3-(4-methylpent-3-en-1-yl)oxiran-2-yl]methanol
- 2,3-Epoxy-3,7-dimethyloct-6-enol
- 2-Oxiranemethanol, 3-methyl-3-(4-methyl-3-penten-1-yl)-
- 3-Methyl-3-(4-methyl-3-penten-1-yl)-2-oxiranemethanol
- 6-Octen-1-ol, 2,3-epoxy-3,7-dimethyl-
- Oxiranemethanol, 3-methyl-3-(4-methyl-3-pentenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
